![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Boogie Chillen 2.wma | 2012-01-24 11:30 | 3.6M | |
| 02 I'm in the Mood.wma | 2012-01-24 11:30 | 3.8M | |
| 03 Boom Boom.wma | 2012-01-24 11:30 | 3.5M | |
| 04 Dimples.wma | 2012-01-24 11:30 | 3.1M | |
| 05 Hobo Blues.wma | 2012-01-24 11:30 | 3.8M | |
| 06 Dusty Road.wma | 2012-01-24 11:30 | 3.1M | |
| 07 House Rent Boogie..> | 2012-01-24 11:30 | 5.6M | |
| 08 No Shoes.wma | 2012-01-24 11:30 | 3.4M | |
| 09 I'm So Excited.wma | 2012-01-24 11:30 | 3.9M | |
| 10 Baby Lee.wma | 2012-01-24 11:30 | 3.8M | |
| 11 Bottle Up and Go.wma | 2012-01-24 11:30 | 3.5M | |
| 12 Drug Store Woman.wma | 2012-01-24 11:30 | 3.8M | |
| 13 Frisco.wma | 2012-01-24 11:30 | 3.8M | |
| 14 Whiskey and Wimme..> | 2012-01-24 11:30 | 3.7M | |
| 15 Process.wma | 2012-01-24 11:30 | 5.2M | |
| 16 Trouble Blues.wma | 2012-01-24 11:30 | 3.9M | |
| 17 Onions.wma | 2012-01-24 11:30 | 3.0M | |
| 18 Good Rockin' Mama..> | 2012-01-24 11:30 | 3.7M | |
| AlbumArtSmall.jpg | 2014-04-05 23:01 | 2.2K | |
| AlbumArt_{CF643543-6..> | 2014-04-05 23:01 | 10K | |
| AlbumArt_{CF643543-6..> | 2014-04-05 23:01 | 2.2K | |
| Folder.jpg | 2014-04-05 23:01 | 10K | |
| desktop.ini | 2014-04-05 23:01 | 373 | |