![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 In France They Ki..> | 2012-01-27 16:55 | 3.1M | |
| 02 The Jungle Line.m4a | 2012-01-27 16:55 | 4.1M | |
| 03 Edith And The Kin..> | 2012-01-27 16:55 | 3.4M | |
| 04 Don't Interrupt T..> | 2012-01-27 16:55 | 3.8M | |
| 05 Shades Of Scarlet..> | 2012-01-27 16:55 | 4.6M | |
| 06 The Hissing Of Su..> | 2012-01-27 16:55 | 2.8M | |
| 07 The Boho Dance.m4a | 2012-01-27 16:55 | 3.5M | |
| 08 Harry's House_Cen..> | 2012-01-27 16:55 | 6.3M | |
| 09 Sweet Bird.m4a | 2012-01-27 16:55 | 3.9M | |
| 10 Shadows And Light..> | 2012-01-27 16:55 | 4.0M | |