![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 2-04 Down On Love.m4a | 2014-11-29 16:05 | 3.8M | |
| 2-05 Reaction To Act..> | 2014-11-29 16:05 | 3.2M | |
| 2-07 Midnight Blue.m4a | 2014-11-29 16:05 | 3.6M | |
| 2-08 Heart Turns To ..> | 2014-11-29 16:05 | 3.9M | |
| 2-10 Say You Will.m4a | 2014-11-29 16:05 | 3.9M | |
| 2-11 Just Wanna Hold..> | 2014-11-29 16:05 | 3.3M | |
| 2-12 Just Between Yo..> | 2014-11-29 16:05 | 4.6M | |
| AlbumArtSmall.jpg | 2014-11-29 16:05 | 5.3K | |
| AlbumArt_{11E1EA6D-0..> | 2014-11-29 16:05 | 19K | |
| AlbumArt_{11E1EA6D-0..> | 2014-11-29 16:05 | 5.3K | |
| Folder.jpg | 2014-11-29 16:05 | 19K | |
| desktop.ini | 2014-11-29 16:05 | 318 | |