![[ICO]](/icons/blank.gif){kind=icon}
![[PARENTDIR]](/icons/back.gif){kind=icon}
![[SND]](/icons/sound2.gif){kind=icon}
![[IMG]](/icons/image2.gif){kind=icon}
![[ ]](/icons/unknown.gif){kind=icon}
| Name | Last modified | Size | Description |
|---|---|---|---|---|
| Parent Directory | - | ||
| 01 Stranger in a Str..> | 2012-01-22 14:14 | 3.7M | |
| 02 Of Thee I Sing.m4a | 2012-01-22 14:14 | 4.1M | |
| 03 It's a Hard Rain ..> | 2012-01-22 14:14 | 4.8M | |
| 04 Crystal Closet Qu..> | 2012-01-22 14:14 | 2.8M | |
| 05 Home Sweet Oklaho..> | 2012-01-22 14:14 | 3.2M | |
| 06 Alcatraz.m4a | 2012-01-22 14:14 | 3.6M | |
| 07 The Ballad of Mad..> | 2012-01-22 14:14 | 3.7M | |
| 08 It Takes a Lot to..> | 2012-01-22 14:14 | 3.7M | |
| 09 She Smiles Like a..> | 2012-01-22 14:14 | 2.8M | |
| 10 Sweet Emily.m4a | 2012-01-22 14:14 | 3.1M | |
| 11 Beware of Darknes..> | 2012-01-22 14:14 | 4.3M | |
| 12 It's All Over Now..> | 2012-01-22 14:14 | 3.4M | |
| 13 Love Minus Zero _..> | 2012-01-22 14:14 | 3.1M | |
| 14 She Belongs to Me..> | 2012-01-22 14:14 | 3.2M | |
| AlbumArtSmall.jpg | 2014-04-05 22:59 | 2.7K | |
| AlbumArt_{9E28F79D-4..> | 2014-04-05 22:59 | 9.3K | |
| AlbumArt_{9E28F79D-4..> | 2014-04-05 22:59 | 2.7K | |
| Folder.jpg | 2014-04-05 22:59 | 9.3K | |
| desktop.ini | 2014-04-05 22:59 | 397 | |